C11H18 — CID 123750976
3,7-dimethylbicyclo[3.3.1]non-1-ene (PubChem CID 123750976) has the molecular formula C11H18 and a molecular weight of 150.26 g/mol. Its IUPAC name is 3,7-dimethylbicyclo[3.3.1]non-1-ene.
| Compound Name | 3,7-dimethylbicyclo[3.3.1]non-1-ene |
|---|---|
| PubChem CID | 123750976 |
| Molecular Formula | C11H18 |
| Molecular Weight | 150.26 g/mol |
| Exact Mass | 150.14 |
| IUPAC Name | 3,7-dimethylbicyclo[3.3.1]non-1-ene |
| SMILES | CC1C=C2CC(C)CC(C2)C1 |
| InChI | InChI=1S/C11H18/c1-8-3-10-5-9(2)6-11(4-8)7-10/h3,8-9,11H,4-7H2,1-2H3 |
| InChIKey | TYLDYRXUSGMCFR-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.26 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|