C7H10Cl2 — CID 123341326
1,3-dichloro-5-methylcyclohexene (PubChem CID 123341326) has the molecular formula C7H10Cl2 and a molecular weight of 165.06 g/mol. Its IUPAC name is 1,3-dichloro-5-methylcyclohexene.
| Compound Name | 1,3-dichloro-5-methylcyclohexene |
|---|---|
| PubChem CID | 123341326 |
| Molecular Formula | C7H10Cl2 |
| Molecular Weight | 165.06 g/mol |
| Exact Mass | 164.02 |
| IUPAC Name | 1,3-dichloro-5-methylcyclohexene |
| SMILES | CC1CC(Cl)=CC(Cl)C1 |
| InChI | InChI=1S/C7H10Cl2/c1-5-2-6(8)4-7(9)3-5/h4-6H,2-3H2,1H3 |
| InChIKey | LTWARAYAJXVLRP-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.06 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|