C13H23N — CID 144522331
N,4,8-trimethylbicyclo[4.3.1]dec-5-en-3-amine (PubChem CID 144522331) has the molecular formula C13H23N and a molecular weight of 193.33 g/mol. Its IUPAC name is N,4,8-trimethylbicyclo[4.3.1]dec-5-en-3-amine.
| Compound Name | N,4,8-trimethylbicyclo[4.3.1]dec-5-en-3-amine |
|---|---|
| PubChem CID | 144522331 |
| Molecular Formula | C13H23N |
| Molecular Weight | 193.33 g/mol |
| Exact Mass | 193.18 |
| IUPAC Name | N,4,8-trimethylbicyclo[4.3.1]dec-5-en-3-amine |
| SMILES | CNC1CC2CC(=CC1C)CC(C)C2 |
| InChI | InChI=1S/C13H23N/c1-9-4-11-6-10(2)13(14-3)8-12(5-9)7-11/h6,9-10,12-14H,4-5,7-8H2,1-3H3 |
| InChIKey | QWALTSITRBTUGJ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.33 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|