C12H20OS2 — CID 10444537
methylsulfanyl(3,3,6-trimethylhepta-1,5-dien-4-ylsulfanyl)methanone (PubChem CID 10444537) has the molecular formula C12H20OS2 and a molecular weight of 244.42 g/mol. Its IUPAC name is methylsulfanyl(3,3,6-trimethylhepta-1,5-dien-4-ylsulfanyl)methanone.
| Compound Name | methylsulfanyl(3,3,6-trimethylhepta-1,5-dien-4-ylsulfanyl)methanone |
|---|---|
| PubChem CID | 10444537 |
| Molecular Formula | C12H20OS2 |
| Molecular Weight | 244.42 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | methylsulfanyl(3,3,6-trimethylhepta-1,5-dien-4-ylsulfanyl)methanone |
| SMILES | C=CC(C)(C)C(C=C(C)C)SC(=O)SC |
| InChI | InChI=1S/C12H20OS2/c1-7-12(4,5)10(8-9(2)3)15-11(13)14-6/h7-8,10H,1H2,2-6H3 |
| InChIKey | QLFUSNWXEVBOPX-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.42 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|