About (3S)-4,4-dimethyl-3-(phosphanylamino)hex-5-en-2-one
(3S)-4,4-dimethyl-3-(phosphanylamino)hex-5-en-2-one (PubChem CID 121323798) has the molecular formula C8H16NOP
and a molecular weight of 173.20 g/mol. Its IUPAC name is (3S)-4,4-dimethyl-3-(phosphanylamino)hex-5-en-2-one.
Molecular Properties
| Compound Name | (3S)-4,4-dimethyl-3-(phosphanylamino)hex-5-en-2-one |
| PubChem CID | 121323798 |
| Molecular Formula | C8H16NOP |
| Molecular Weight | 173.20 g/mol |
| Exact Mass | 173.10 |
| IUPAC Name | (3S)-4,4-dimethyl-3-(phosphanylamino)hex-5-en-2-one |
| SMILES | C=CC(C)(C)[C@H](NP)C(C)=O |
| InChI | InChI=1S/C8H16NOP/c1-5-8(3,4)7(9-11)6(2)10/h5,7,9H,1,11H2,2-4H3/t7-/m1/s1 |
| InChIKey | USBPNEMSYHVIJV-SSDOTTSWSA-N |
| XLogP | 1.54 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.20 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (3S)-4,4-dimethyl-3-(phosphanylamino)hex-5-en-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-4,4-dimethyl-3-(phosphanylamino)hex-5-en-2-one?
The IUPAC name of (3S)-4,4-dimethyl-3-(phosphanylamino)hex-5-en-2-one (CID 121323798) is (3S)-4,4-dimethyl-3-(phosphanylamino)hex-5-en-2-one.
What is the SMILES notation for (3S)-4,4-dimethyl-3-(phosphanylamino)hex-5-en-2-one?
The canonical SMILES for (3S)-4,4-dimethyl-3-(phosphanylamino)hex-5-en-2-one is C=CC(C)(C)[C@H](NP)C(C)=O.
What is the InChIKey of (3S)-4,4-dimethyl-3-(phosphanylamino)hex-5-en-2-one?
The InChIKey is USBPNEMSYHVIJV-SSDOTTSWSA-N. The full InChI is InChI=1S/C8H16NOP/c1-5-8(3,4)7(9-11)6(2)10/h5,7,9H,1,11H2,2-4H3/t7-/m1/s1.
What are the key properties of (3S)-4,4-dimethyl-3-(phosphanylamino)hex-5-en-2-one?
(3S)-4,4-dimethyl-3-(phosphanylamino)hex-5-en-2-one has a molecular weight of 173.20 g/mol, XLogP of 1.54, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-4,4-dimethyl-3-(phosphanylamino)hex-5-en-2-one is sourced from PubChem (CID 121323798), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).