C8H16NOP — CID 121323798
(3S)-4,4-dimethyl-3-(phosphanylamino)hex-5-en-2-one (PubChem CID 121323798) has the molecular formula C8H16NOP and a molecular weight of 173.20 g/mol. Its IUPAC name is (3S)-4,4-dimethyl-3-(phosphanylamino)hex-5-en-2-one.
| Compound Name | (3S)-4,4-dimethyl-3-(phosphanylamino)hex-5-en-2-one |
|---|---|
| PubChem CID | 121323798 |
| Molecular Formula | C8H16NOP |
| Molecular Weight | 173.20 g/mol |
| Exact Mass | 173.10 |
| IUPAC Name | (3S)-4,4-dimethyl-3-(phosphanylamino)hex-5-en-2-one |
| SMILES | C=CC(C)(C)[C@H](NP)C(C)=O |
| InChI | InChI=1S/C8H16NOP/c1-5-8(3,4)7(9-11)6(2)10/h5,7,9H,1,11H2,2-4H3/t7-/m1/s1 |
| InChIKey | USBPNEMSYHVIJV-SSDOTTSWSA-N |
| XLogP | 1.54 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.20 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|