C10H12BrN3 — CID 10445004
5-bromo-1,2,6-trimethylbenzimidazol-4-amine (PubChem CID 10445004) has the molecular formula C10H12BrN3 and a molecular weight of 254.13 g/mol. Its IUPAC name is 5-bromo-1,2,6-trimethylbenzimidazol-4-amine.
| Compound Name | 5-bromo-1,2,6-trimethylbenzimidazol-4-amine |
|---|---|
| PubChem CID | 10445004 |
| Molecular Formula | C10H12BrN3 |
| Molecular Weight | 254.13 g/mol |
| Exact Mass | 253.02 |
| IUPAC Name | 5-bromo-1,2,6-trimethylbenzimidazol-4-amine |
| SMILES | Cc1cc2c(nc(C)n2C)c(N)c1Br |
| InChI | InChI=1S/C10H12BrN3/c1-5-4-7-10(9(12)8(5)11)13-6(2)14(7)3/h4H,12H2,1-3H3 |
| InChIKey | MYIVANBXFOALTD-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.13 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|