C19H19NO3 — CID 10448050
(1R,2R,3S,6R,8S)-3,4-diphenyl-5,10,11-trioxa-4-azatricyclo[6.2.1.02,6]undecane (PubChem CID 10448050) has the molecular formula C19H19NO3 and a molecular weight of 309.37 g/mol. Its IUPAC name is (1R,2R,3S,6R,8S)-3,4-diphenyl-5,10,11-trioxa-4-azatricyclo[6.2.1.02,6]undecane.
| Compound Name | (1R,2R,3S,6R,8S)-3,4-diphenyl-5,10,11-trioxa-4-azatricyclo[6.2.1.02,6]undecane |
|---|---|
| PubChem CID | 10448050 |
| Molecular Formula | C19H19NO3 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | (1R,2R,3S,6R,8S)-3,4-diphenyl-5,10,11-trioxa-4-azatricyclo[6.2.1.02,6]undecane |
| SMILES | c1ccc([C@@H]2[C@H]3[C@@H]4OC[C@H](C[C@H]3ON2c2ccccc2)O4)cc1 |
| InChI | InChI=1S/C19H19NO3/c1-3-7-13(8-4-1)18-17-16(11-15-12-21-19(17)22-15)23-20(18)14-9-5-2-6-10-14/h1-10,15-19H,11-12H2/t15-,16+,17-,18+,19+/m0/s1 |
| InChIKey | QEVYTHZHXHXWOC-ZWJWXYIHSA-N |
| XLogP | 3.31 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |