C18H23NO5 — CID 24879778
(1R,9S,10R,14R)-9,12,12-trimethyl-3-phenyl-4,8,11,13,15-pentaoxa-3-azatetracyclo[7.6.0.02,6.010,14]pentadecane (PubChem CID 24879778) has the molecular formula C18H23NO5 and a molecular weight of 333.38 g/mol. Its IUPAC name is (1R,9S,10R,14R)-9,12,12-trimethyl-3-phenyl-4,8,11,13,15-pentaoxa-3-azatetracyclo[7.6.0.02,6.010,14]pentadecane.
| Compound Name | (1R,9S,10R,14R)-9,12,12-trimethyl-3-phenyl-4,8,11,13,15-pentaoxa-3-azatetracyclo[7.6.0.02,6.010,14]pentadecane |
|---|---|
| PubChem CID | 24879778 |
| Molecular Formula | C18H23NO5 |
| Molecular Weight | 333.38 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | (1R,9S,10R,14R)-9,12,12-trimethyl-3-phenyl-4,8,11,13,15-pentaoxa-3-azatetracyclo[7.6.0.02,6.010,14]pentadecane |
| SMILES | CC1(C)O[C@H]2O[C@@H]3C4C(CON4c4ccccc4)CO[C@]3(C)[C@H]2O1 |
| InChI | InChI=1S/C18H23NO5/c1-17(2)23-15-16(24-17)22-14-13-11(9-20-18(14,15)3)10-21-19(13)12-7-5-4-6-8-12/h4-8,11,13-16H,9-10H2,1-3H3/t11?,13?,14-,15+,16-,18+/m1/s1 |
| InChIKey | CRAAPKBDDZETRZ-VKVJCTETSA-N |
| XLogP | 2.09 |
| TPSA | 49.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.38 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |