C19H25NO5 — CID 11667393
(1R,2S,6R,9S,10R,14R)-5,5,12,12-tetramethyl-3-phenyl-4,8,11,13,15-pentaoxa-3-azatetracyclo[7.6.0.02,6.010,14]pentadecane (PubChem CID 11667393) has the molecular formula C19H25NO5 and a molecular weight of 347.41 g/mol. Its IUPAC name is (1R,2S,6R,9S,10R,14R)-5,5,12,12-tetramethyl-3-phenyl-4,8,11,13,15-pentaoxa-3-azatetracyclo[7.6.0.02,6.010,14]pentadecane.
| Compound Name | (1R,2S,6R,9S,10R,14R)-5,5,12,12-tetramethyl-3-phenyl-4,8,11,13,15-pentaoxa-3-azatetracyclo[7.6.0.02,6.010,14]pentadecane |
|---|---|
| PubChem CID | 11667393 |
| Molecular Formula | C19H25NO5 |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | (1R,2S,6R,9S,10R,14R)-5,5,12,12-tetramethyl-3-phenyl-4,8,11,13,15-pentaoxa-3-azatetracyclo[7.6.0.02,6.010,14]pentadecane |
| SMILES | CC1(C)O[C@H]2O[C@H]3[C@H](OC[C@H]4[C@@H]3N(c3ccccc3)OC4(C)C)[C@H]2O1 |
| InChI | InChI=1S/C19H25NO5/c1-18(2)12-10-21-15-14(22-17-16(15)23-19(3,4)24-17)13(12)20(25-18)11-8-6-5-7-9-11/h5-9,12-17H,10H2,1-4H3/t12-,13-,14+,15-,16+,17+/m0/s1 |
| InChIKey | GJKIKDONPSONTG-YHPRMOQLSA-N |
| XLogP | 2.48 |
| TPSA | 49.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |