C17H21NO5 — CID 11681273
(1S,2R,4R,8R,9S,12R)-6,6-dimethyl-14-phenyl-3,5,7,10,13-pentaoxa-14-azatetracyclo[10.2.1.02,9.04,8]pentadecane (PubChem CID 11681273) has the molecular formula C17H21NO5 and a molecular weight of 319.36 g/mol. Its IUPAC name is (1S,2R,4R,8R,9S,12R)-6,6-dimethyl-14-phenyl-3,5,7,10,13-pentaoxa-14-azatetracyclo[10.2.1.02,9.04,8]pentadecane.
| Compound Name | (1S,2R,4R,8R,9S,12R)-6,6-dimethyl-14-phenyl-3,5,7,10,13-pentaoxa-14-azatetracyclo[10.2.1.02,9.04,8]pentadecane |
|---|---|
| PubChem CID | 11681273 |
| Molecular Formula | C17H21NO5 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | (1S,2R,4R,8R,9S,12R)-6,6-dimethyl-14-phenyl-3,5,7,10,13-pentaoxa-14-azatetracyclo[10.2.1.02,9.04,8]pentadecane |
| SMILES | CC1(C)O[C@H]2O[C@H]3[C@H](OC[C@H]4C[C@@H]3N(c3ccccc3)O4)[C@H]2O1 |
| InChI | InChI=1S/C17H21NO5/c1-17(2)21-15-14-13(20-16(15)22-17)12-8-11(9-19-14)23-18(12)10-6-4-3-5-7-10/h3-7,11-16H,8-9H2,1-2H3/t11-,12+,13-,14+,15-,16-/m1/s1 |
| InChIKey | UDDFBIPULIIBLT-ZTYXSZCMSA-N |
| XLogP | 1.84 |
| TPSA | 49.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |