C18H23NO5 — CID 24879777
(1S,2R,4R,8R,9S,12R)-6,6,9-trimethyl-14-phenyl-3,5,7,10,13-pentaoxa-14-azatetracyclo[10.2.1.02,9.04,8]pentadecane (PubChem CID 24879777) has the molecular formula C18H23NO5 and a molecular weight of 333.38 g/mol. Its IUPAC name is (1S,2R,4R,8R,9S,12R)-6,6,9-trimethyl-14-phenyl-3,5,7,10,13-pentaoxa-14-azatetracyclo[10.2.1.02,9.04,8]pentadecane.
| Compound Name | (1S,2R,4R,8R,9S,12R)-6,6,9-trimethyl-14-phenyl-3,5,7,10,13-pentaoxa-14-azatetracyclo[10.2.1.02,9.04,8]pentadecane |
|---|---|
| PubChem CID | 24879777 |
| Molecular Formula | C18H23NO5 |
| Molecular Weight | 333.38 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | (1S,2R,4R,8R,9S,12R)-6,6,9-trimethyl-14-phenyl-3,5,7,10,13-pentaoxa-14-azatetracyclo[10.2.1.02,9.04,8]pentadecane |
| SMILES | CC1(C)O[C@H]2O[C@@H]3[C@@H]4C[C@H](CO[C@]3(C)[C@H]2O1)ON4c1ccccc1 |
| InChI | InChI=1S/C18H23NO5/c1-17(2)22-15-16(23-17)21-14-13-9-12(10-20-18(14,15)3)24-19(13)11-7-5-4-6-8-11/h4-8,12-16H,9-10H2,1-3H3/t12-,13+,14-,15+,16-,18+/m1/s1 |
| InChIKey | LACRWGKGJIRTFC-HOIZKXCTSA-N |
| XLogP | 2.23 |
| TPSA | 49.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.38 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |