C18H32O4 — CID 10448243
(E,4R)-7-[(4R,5S)-4-[(2S)-butan-2-yl]-2,2-dimethyl-1,3-dioxan-5-yl]-4-methylhept-6-enoic acid (PubChem CID 10448243) has the molecular formula C18H32O4 and a molecular weight of 312.45 g/mol. Its IUPAC name is (E,4R)-7-[(4R,5S)-4-[(2S)-butan-2-yl]-2,2-dimethyl-1,3-dioxan-5-yl]-4-methylhept-6-enoic acid.
| Compound Name | (E,4R)-7-[(4R,5S)-4-[(2S)-butan-2-yl]-2,2-dimethyl-1,3-dioxan-5-yl]-4-methylhept-6-enoic acid |
|---|---|
| PubChem CID | 10448243 |
| Molecular Formula | C18H32O4 |
| Molecular Weight | 312.45 g/mol |
| Exact Mass | 312.23 |
| IUPAC Name | (E,4R)-7-[(4R,5S)-4-[(2S)-butan-2-yl]-2,2-dimethyl-1,3-dioxan-5-yl]-4-methylhept-6-enoic acid |
| SMILES | CC[C@H](C)[C@H]1OC(C)(C)OC[C@@H]1/C=C/C[C@H](C)CCC(=O)O |
| InChI | InChI=1S/C18H32O4/c1-6-14(3)17-15(12-21-18(4,5)22-17)9-7-8-13(2)10-11-16(19)20/h7,9,13-15,17H,6,8,10-12H2,1-5H3,(H,19,20)/b9-7+/t13-,14-,15-,17+/m0/s1 |
| InChIKey | FBAKPLDPWKHFMI-NXBILRBRSA-N |
| XLogP | 4.25 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.45 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|