C18H34OSi2 — CID 10448835
triethyl-[methoxy-[(1R,4S)-3-trimethylsilyl-2-bicyclo[2.2.1]hepta-2,5-dienyl]methyl]silane (PubChem CID 10448835) has the molecular formula C18H34OSi2 and a molecular weight of 322.64 g/mol. Its IUPAC name is triethyl-[methoxy-[(1R,4S)-3-trimethylsilyl-2-bicyclo[2.2.1]hepta-2,5-dienyl]methyl]silane.
| Compound Name | triethyl-[methoxy-[(1R,4S)-3-trimethylsilyl-2-bicyclo[2.2.1]hepta-2,5-dienyl]methyl]silane |
|---|---|
| PubChem CID | 10448835 |
| Molecular Formula | C18H34OSi2 |
| Molecular Weight | 322.64 g/mol |
| Exact Mass | 322.21 |
| IUPAC Name | triethyl-[methoxy-[(1R,4S)-3-trimethylsilyl-2-bicyclo[2.2.1]hepta-2,5-dienyl]methyl]silane |
| SMILES | CC[Si](CC)(CC)C(OC)C1=C([Si](C)(C)C)[C@@H]2C=C[C@H]1C2 |
| InChI | InChI=1S/C18H34OSi2/c1-8-21(9-2,10-3)18(19-4)16-14-11-12-15(13-14)17(16)20(5,6)7/h11-12,14-15,18H,8-10,13H2,1-7H3/t14-,15+,18?/m0/s1 |
| InChIKey | GUYCVYOFMNMRQP-DYNVDGSKSA-N |
| XLogP | 5.43 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.64 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|