C12H18CrOSi — CID 13379859
[methoxy-(3-trimethylsilyl-2-bicyclo[2.2.1]hepta-2,5-dienyl)methylidene]chromium (PubChem CID 13379859) has the molecular formula C12H18CrOSi and a molecular weight of 258.36 g/mol. Its IUPAC name is [methoxy-(3-trimethylsilyl-2-bicyclo[2.2.1]hepta-2,5-dienyl)methylidene]chromium.
| Compound Name | [methoxy-(3-trimethylsilyl-2-bicyclo[2.2.1]hepta-2,5-dienyl)methylidene]chromium |
|---|---|
| PubChem CID | 13379859 |
| Molecular Formula | C12H18CrOSi |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.05 |
| IUPAC Name | [methoxy-(3-trimethylsilyl-2-bicyclo[2.2.1]hepta-2,5-dienyl)methylidene]chromium |
| SMILES | COC(=[Cr])C1=C([Si](C)(C)C)C2C=CC1C2 |
| InChI | InChI=1S/C12H18OSi.Cr/c1-13-8-11-9-5-6-10(7-9)12(11)14(2,3)4;/h5-6,9-10H,7H2,1-4H3; |
| InChIKey | JNYUOMGEDRSFQC-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|