C13H20CrOSi — CID 13379863
[ethoxy-(3-trimethylsilyl-2-bicyclo[2.2.1]hepta-2,5-dienyl)methylidene]chromium (PubChem CID 13379863) has the molecular formula C13H20CrOSi and a molecular weight of 272.38 g/mol. Its IUPAC name is [ethoxy-(3-trimethylsilyl-2-bicyclo[2.2.1]hepta-2,5-dienyl)methylidene]chromium.
| Compound Name | [ethoxy-(3-trimethylsilyl-2-bicyclo[2.2.1]hepta-2,5-dienyl)methylidene]chromium |
|---|---|
| PubChem CID | 13379863 |
| Molecular Formula | C13H20CrOSi |
| Molecular Weight | 272.38 g/mol |
| Exact Mass | 272.07 |
| IUPAC Name | [ethoxy-(3-trimethylsilyl-2-bicyclo[2.2.1]hepta-2,5-dienyl)methylidene]chromium |
| SMILES | CCOC(=[Cr])C1=C([Si](C)(C)C)C2C=CC1C2 |
| InChI | InChI=1S/C13H20OSi.Cr/c1-5-14-9-12-10-6-7-11(8-10)13(12)15(2,3)4;/h6-7,10-11H,5,8H2,1-4H3; |
| InChIKey | OOKIHAINGZTCQG-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.38 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|