C15H24N2O2S — CID 104501609
N-[3-(4-aminophenyl)butyl]-3-methyl-1,1-dioxothiolan-3-amine (PubChem CID 104501609) has the molecular formula C15H24N2O2S and a molecular weight of 296.44 g/mol. Its IUPAC name is N-[3-(4-aminophenyl)butyl]-3-methyl-1,1-dioxothiolan-3-amine.
| Compound Name | N-[3-(4-aminophenyl)butyl]-3-methyl-1,1-dioxothiolan-3-amine |
|---|---|
| PubChem CID | 104501609 |
| Molecular Formula | C15H24N2O2S |
| Molecular Weight | 296.44 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | N-[3-(4-aminophenyl)butyl]-3-methyl-1,1-dioxothiolan-3-amine |
| SMILES | CC(CCNC1(C)CCS(=O)(=O)C1)c1ccc(N)cc1 |
| InChI | InChI=1S/C15H24N2O2S/c1-12(13-3-5-14(16)6-4-13)7-9-17-15(2)8-10-20(18,19)11-15/h3-6,12,17H,7-11,16H2,1-2H3 |
| InChIKey | KDECNFKWXKZLCB-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.44 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|