C13H12BrNO — CID 104508949
6-bromo-8-methyl-2,3,4,9-tetrahydrocarbazol-1-one (PubChem CID 104508949) has the molecular formula C13H12BrNO and a molecular weight of 278.15 g/mol. Its IUPAC name is 6-bromo-8-methyl-2,3,4,9-tetrahydrocarbazol-1-one.
| Compound Name | 6-bromo-8-methyl-2,3,4,9-tetrahydrocarbazol-1-one |
|---|---|
| PubChem CID | 104508949 |
| Molecular Formula | C13H12BrNO |
| Molecular Weight | 278.15 g/mol |
| Exact Mass | 277.01 |
| IUPAC Name | 6-bromo-8-methyl-2,3,4,9-tetrahydrocarbazol-1-one |
| SMILES | Cc1cc(Br)cc2c3c([nH]c12)C(=O)CCC3 |
| InChI | InChI=1S/C13H12BrNO/c1-7-5-8(14)6-10-9-3-2-4-11(16)13(9)15-12(7)10/h5-6,15H,2-4H2,1H3 |
| InChIKey | HAQOJSLARAALOY-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.15 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|