C12H14BrN — CID 84707640
5-bromo-2-ethyl-3,7-dimethyl-1H-indole (PubChem CID 84707640) has the molecular formula C12H14BrN and a molecular weight of 252.15 g/mol. Its IUPAC name is 5-bromo-2-ethyl-3,7-dimethyl-1H-indole.
| Compound Name | 5-bromo-2-ethyl-3,7-dimethyl-1H-indole |
|---|---|
| PubChem CID | 84707640 |
| Molecular Formula | C12H14BrN |
| Molecular Weight | 252.15 g/mol |
| Exact Mass | 251.03 |
| IUPAC Name | 5-bromo-2-ethyl-3,7-dimethyl-1H-indole |
| SMILES | CCc1[nH]c2c(C)cc(Br)cc2c1C |
| InChI | InChI=1S/C12H14BrN/c1-4-11-8(3)10-6-9(13)5-7(2)12(10)14-11/h5-6,14H,4H2,1-3H3 |
| InChIKey | LXEVIIDMDIGRJT-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.15 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|