C17H18ClFN6 — CID 10451188
6-chloro-N,N-diethyl-3-[[2-(6-fluoro-2-pyridinyl)imidazol-1-yl]methyl]pyridazin-4-amine (PubChem CID 10451188) has the molecular formula C17H18ClFN6 and a molecular weight of 360.82 g/mol. Its IUPAC name is 6-chloro-N,N-diethyl-3-[[2-(6-fluoro-2-pyridinyl)imidazol-1-yl]methyl]pyridazin-4-amine.
| Compound Name | 6-chloro-N,N-diethyl-3-[[2-(6-fluoro-2-pyridinyl)imidazol-1-yl]methyl]pyridazin-4-amine |
|---|---|
| PubChem CID | 10451188 |
| Molecular Formula | C17H18ClFN6 |
| Molecular Weight | 360.82 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | 6-chloro-N,N-diethyl-3-[[2-(6-fluoro-2-pyridinyl)imidazol-1-yl]methyl]pyridazin-4-amine |
| SMILES | CCN(CC)c1cc(Cl)nnc1Cn1ccnc1-c1cccc(F)n1 |
| InChI | InChI=1S/C17H18ClFN6/c1-3-24(4-2)14-10-15(18)23-22-13(14)11-25-9-8-20-17(25)12-6-5-7-16(19)21-12/h5-10H,3-4,11H2,1-2H3 |
| InChIKey | BLSMIHGSXWMBJI-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 59.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.82 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|