C16H14FN5S — CID 22335063
5-ethyl-6-[[2-(6-fluoro-2-pyridinyl)imidazol-1-yl]methyl]imidazo[2,1-b][1,3]thiazole (PubChem CID 22335063) has the molecular formula C16H14FN5S and a molecular weight of 327.39 g/mol. Its IUPAC name is 5-ethyl-6-[[2-(6-fluoro-2-pyridinyl)imidazol-1-yl]methyl]imidazo[2,1-b][1,3]thiazole.
| Compound Name | 5-ethyl-6-[[2-(6-fluoro-2-pyridinyl)imidazol-1-yl]methyl]imidazo[2,1-b][1,3]thiazole |
|---|---|
| PubChem CID | 22335063 |
| Molecular Formula | C16H14FN5S |
| Molecular Weight | 327.39 g/mol |
| Exact Mass | 327.10 |
| IUPAC Name | 5-ethyl-6-[[2-(6-fluoro-2-pyridinyl)imidazol-1-yl]methyl]imidazo[2,1-b][1,3]thiazole |
| SMILES | CCc1c(Cn2ccnc2-c2cccc(F)n2)nc2sccn12 |
| InChI | InChI=1S/C16H14FN5S/c1-2-13-12(20-16-22(13)8-9-23-16)10-21-7-6-18-15(21)11-4-3-5-14(17)19-11/h3-9H,2,10H2,1H3 |
| InChIKey | NIXILFJVLKDGLU-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 48.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.39 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|