C18H18ClN7 — CID 87940435
2-[[2-(6-chloro-2-pyridinyl)imidazol-1-yl]methyl]-3-ethyl-N-methylimidazo[1,2-b]pyridazin-6-amine (PubChem CID 87940435) has the molecular formula C18H18ClN7 and a molecular weight of 367.84 g/mol. Its IUPAC name is 2-[[2-(6-chloro-2-pyridinyl)imidazol-1-yl]methyl]-3-ethyl-N-methylimidazo[1,2-b]pyridazin-6-amine.
| Compound Name | 2-[[2-(6-chloro-2-pyridinyl)imidazol-1-yl]methyl]-3-ethyl-N-methylimidazo[1,2-b]pyridazin-6-amine |
|---|---|
| PubChem CID | 87940435 |
| Molecular Formula | C18H18ClN7 |
| Molecular Weight | 367.84 g/mol |
| Exact Mass | 367.13 |
| IUPAC Name | 2-[[2-(6-chloro-2-pyridinyl)imidazol-1-yl]methyl]-3-ethyl-N-methylimidazo[1,2-b]pyridazin-6-amine |
| SMILES | CCc1c(Cn2ccnc2-c2cccc(Cl)n2)nc2ccc(NC)nn12 |
| InChI | InChI=1S/C18H18ClN7/c1-3-14-13(23-17-8-7-16(20-2)24-26(14)17)11-25-10-9-21-18(25)12-5-4-6-15(19)22-12/h4-10H,3,11H2,1-2H3,(H,20,24) |
| InChIKey | RWUMEIIYJSZEFF-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 72.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.84 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|