C11H17NO3S — CID 104519592
2-(1,1-dioxothiane-2-carbonyl)-3-methylbutanenitrile (PubChem CID 104519592) has the molecular formula C11H17NO3S and a molecular weight of 243.33 g/mol. Its IUPAC name is 2-(1,1-dioxothiane-2-carbonyl)-3-methylbutanenitrile.
| Compound Name | 2-(1,1-dioxothiane-2-carbonyl)-3-methylbutanenitrile |
|---|---|
| PubChem CID | 104519592 |
| Molecular Formula | C11H17NO3S |
| Molecular Weight | 243.33 g/mol |
| Exact Mass | 243.09 |
| IUPAC Name | 2-(1,1-dioxothiane-2-carbonyl)-3-methylbutanenitrile |
| SMILES | CC(C)C(C#N)C(=O)C1CCCCS1(=O)=O |
| InChI | InChI=1S/C11H17NO3S/c1-8(2)9(7-12)11(13)10-5-3-4-6-16(10,14)15/h8-10H,3-6H2,1-2H3 |
| InChIKey | DSCLQAQFWNRMIJ-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 75.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.33 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |