C23H32O2SSi — CID 10453645
methyl (2S,3R)-3-[dimethyl(phenyl)silyl]-2,5-dimethyl-2-phenylsulfanylhexanoate (PubChem CID 10453645) has the molecular formula C23H32O2SSi and a molecular weight of 400.66 g/mol. Its IUPAC name is methyl (2S,3R)-3-[dimethyl(phenyl)silyl]-2,5-dimethyl-2-phenylsulfanylhexanoate.
| Compound Name | methyl (2S,3R)-3-[dimethyl(phenyl)silyl]-2,5-dimethyl-2-phenylsulfanylhexanoate |
|---|---|
| PubChem CID | 10453645 |
| Molecular Formula | C23H32O2SSi |
| Molecular Weight | 400.66 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | methyl (2S,3R)-3-[dimethyl(phenyl)silyl]-2,5-dimethyl-2-phenylsulfanylhexanoate |
| SMILES | COC(=O)[C@](C)(Sc1ccccc1)[C@@H](CC(C)C)[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C23H32O2SSi/c1-18(2)17-21(27(5,6)20-15-11-8-12-16-20)23(3,22(24)25-4)26-19-13-9-7-10-14-19/h7-16,18,21H,17H2,1-6H3/t21-,23-/m1/s1 |
| InChIKey | UDQIFFSHYDZLFT-FYYLOGMGSA-N |
| XLogP | 5.74 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.66 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|