C22H22N4O4 — CID 10454002
methyl 3-cyano-2-[(E)-C-methyl-N-(phenylcarbamoylamino)carbonimidoyl]-4-oxo-3-phenylpentanoate (PubChem CID 10454002) has the molecular formula C22H22N4O4 and a molecular weight of 406.44 g/mol. Its IUPAC name is methyl 3-cyano-2-[(E)-C-methyl-N-(phenylcarbamoylamino)carbonimidoyl]-4-oxo-3-phenylpentanoate.
| Compound Name | methyl 3-cyano-2-[(E)-C-methyl-N-(phenylcarbamoylamino)carbonimidoyl]-4-oxo-3-phenylpentanoate |
|---|---|
| PubChem CID | 10454002 |
| Molecular Formula | C22H22N4O4 |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | methyl 3-cyano-2-[(E)-C-methyl-N-(phenylcarbamoylamino)carbonimidoyl]-4-oxo-3-phenylpentanoate |
| SMILES | COC(=O)C(/C(C)=N/NC(=O)Nc1ccccc1)C(C#N)(C(C)=O)c1ccccc1 |
| InChI | InChI=1S/C22H22N4O4/c1-15(25-26-21(29)24-18-12-8-5-9-13-18)19(20(28)30-3)22(14-23,16(2)27)17-10-6-4-7-11-17/h4-13,19H,1-3H3,(H2,24,26,29)/b25-15+ |
| InChIKey | XIRKEPBSRZDUTL-MFKUBSTISA-N |
| XLogP | 3.02 |
| TPSA | 120.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|