C20H21N5O3 — CID 134915238
methyl (2Z,3E)-3-(phenylcarbamoylhydrazinylidene)-2-[(E)-1-phenylethylidenehydrazinylidene]butanoate (PubChem CID 134915238) has the molecular formula C20H21N5O3 and a molecular weight of 379.42 g/mol. Its IUPAC name is methyl (2Z,3E)-3-(phenylcarbamoylhydrazinylidene)-2-[(E)-1-phenylethylidenehydrazinylidene]butanoate.
| Compound Name | methyl (2Z,3E)-3-(phenylcarbamoylhydrazinylidene)-2-[(E)-1-phenylethylidenehydrazinylidene]butanoate |
|---|---|
| PubChem CID | 134915238 |
| Molecular Formula | C20H21N5O3 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | methyl (2Z,3E)-3-(phenylcarbamoylhydrazinylidene)-2-[(E)-1-phenylethylidenehydrazinylidene]butanoate |
| SMILES | COC(=O)C(=N\N=C(/C)c1ccccc1)/C(C)=N/NC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C20H21N5O3/c1-14(16-10-6-4-7-11-16)22-24-18(19(26)28-3)15(2)23-25-20(27)21-17-12-8-5-9-13-17/h4-13H,1-3H3,(H2,21,25,27)/b22-14+,23-15+,24-18- |
| InChIKey | FFOHUSSAHPROEU-UJRCCHDCSA-N |
| XLogP | 3.22 |
| TPSA | 104.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|