C12H13N5O2Se — CID 177448798
1-[(E)-1-(2-amino-4-hydroxy-1,3-selenazol-5-yl)ethylideneamino]-3-phenylurea (PubChem CID 177448798) has the molecular formula C12H13N5O2Se and a molecular weight of 338.23 g/mol. Its IUPAC name is 1-[(E)-1-(2-amino-4-hydroxy-1,3-selenazol-5-yl)ethylideneamino]-3-phenylurea.
| Compound Name | 1-[(E)-1-(2-amino-4-hydroxy-1,3-selenazol-5-yl)ethylideneamino]-3-phenylurea |
|---|---|
| PubChem CID | 177448798 |
| Molecular Formula | C12H13N5O2Se |
| Molecular Weight | 338.23 g/mol |
| Exact Mass | 339.02 |
| IUPAC Name | 1-[(E)-1-(2-amino-4-hydroxy-1,3-selenazol-5-yl)ethylideneamino]-3-phenylurea |
| SMILES | C/C(=N\NC(=O)Nc1ccccc1)c1[se]c(N)nc1O |
| InChI | InChI=1S/C12H13N5O2Se/c1-7(9-10(18)15-11(13)20-9)16-17-12(19)14-8-5-3-2-4-6-8/h2-6,18H,1H3,(H2,13,15)(H2,14,17,19)/b16-7+ |
| InChIKey | GUCMQVCRZBOPIG-FRKPEAEDSA-N |
| XLogP | 0.97 |
| TPSA | 112.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.23 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|