C18H13NO2 — CID 104542286
2,3-dihydro-1-benzofuran-5-yl(isoquinolin-1-yl)methanone (PubChem CID 104542286) has the molecular formula C18H13NO2 and a molecular weight of 275.31 g/mol. Its IUPAC name is 2,3-dihydro-1-benzofuran-5-yl(isoquinolin-1-yl)methanone.
| Compound Name | 2,3-dihydro-1-benzofuran-5-yl(isoquinolin-1-yl)methanone |
|---|---|
| PubChem CID | 104542286 |
| Molecular Formula | C18H13NO2 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | 2,3-dihydro-1-benzofuran-5-yl(isoquinolin-1-yl)methanone |
| SMILES | O=C(c1ccc2c(c1)CCO2)c1nccc2ccccc12 |
| InChI | InChI=1S/C18H13NO2/c20-18(14-5-6-16-13(11-14)8-10-21-16)17-15-4-2-1-3-12(15)7-9-19-17/h1-7,9,11H,8,10H2 |
| InChIKey | BALYSIWWODLDHS-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |