C10H16ClN3 — CID 104555420
N-(1-chloropropan-2-yl)-N,4,6-trimethylpyrimidin-2-amine (PubChem CID 104555420) has the molecular formula C10H16ClN3 and a molecular weight of 213.71 g/mol. Its IUPAC name is N-(1-chloropropan-2-yl)-N,4,6-trimethylpyrimidin-2-amine.
| Compound Name | N-(1-chloropropan-2-yl)-N,4,6-trimethylpyrimidin-2-amine |
|---|---|
| PubChem CID | 104555420 |
| Molecular Formula | C10H16ClN3 |
| Molecular Weight | 213.71 g/mol |
| Exact Mass | 213.10 |
| IUPAC Name | N-(1-chloropropan-2-yl)-N,4,6-trimethylpyrimidin-2-amine |
| SMILES | Cc1cc(C)nc(N(C)C(C)CCl)n1 |
| InChI | InChI=1S/C10H16ClN3/c1-7-5-8(2)13-10(12-7)14(4)9(3)6-11/h5,9H,6H2,1-4H3 |
| InChIKey | MPAZFUJCNTXIIT-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.71 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|