C9H14ClN3 — CID 104555444
N-(1-chloropropan-2-yl)-N,2-dimethylpyrimidin-4-amine (PubChem CID 104555444) has the molecular formula C9H14ClN3 and a molecular weight of 199.69 g/mol. Its IUPAC name is N-(1-chloropropan-2-yl)-N,2-dimethylpyrimidin-4-amine.
| Compound Name | N-(1-chloropropan-2-yl)-N,2-dimethylpyrimidin-4-amine |
|---|---|
| PubChem CID | 104555444 |
| Molecular Formula | C9H14ClN3 |
| Molecular Weight | 199.69 g/mol |
| Exact Mass | 199.09 |
| IUPAC Name | N-(1-chloropropan-2-yl)-N,2-dimethylpyrimidin-4-amine |
| SMILES | Cc1nccc(N(C)C(C)CCl)n1 |
| InChI | InChI=1S/C9H14ClN3/c1-7(6-10)13(3)9-4-5-11-8(2)12-9/h4-5,7H,6H2,1-3H3 |
| InChIKey | MGPZRAODHLJTTK-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.69 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|