C10H14Cl2N2 — CID 130588443
3-chloro-N-(1-chloropropan-2-yl)-N,2-dimethylpyridin-4-amine (PubChem CID 130588443) has the molecular formula C10H14Cl2N2 and a molecular weight of 233.14 g/mol. Its IUPAC name is 3-chloro-N-(1-chloropropan-2-yl)-N,2-dimethylpyridin-4-amine.
| Compound Name | 3-chloro-N-(1-chloropropan-2-yl)-N,2-dimethylpyridin-4-amine |
|---|---|
| PubChem CID | 130588443 |
| Molecular Formula | C10H14Cl2N2 |
| Molecular Weight | 233.14 g/mol |
| Exact Mass | 232.05 |
| IUPAC Name | 3-chloro-N-(1-chloropropan-2-yl)-N,2-dimethylpyridin-4-amine |
| SMILES | Cc1nccc(N(C)C(C)CCl)c1Cl |
| InChI | InChI=1S/C10H14Cl2N2/c1-7(6-11)14(3)9-4-5-13-8(2)10(9)12/h4-5,7H,6H2,1-3H3 |
| InChIKey | MEMPJCWCPKTZQC-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.14 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|