C13H14N2O4S — CID 104573464
diethyl 2-thieno[3,2-d]pyrimidin-4-ylpropanedioate (PubChem CID 104573464) has the molecular formula C13H14N2O4S and a molecular weight of 294.33 g/mol. Its IUPAC name is diethyl 2-thieno[3,2-d]pyrimidin-4-ylpropanedioate.
| Compound Name | diethyl 2-thieno[3,2-d]pyrimidin-4-ylpropanedioate |
|---|---|
| PubChem CID | 104573464 |
| Molecular Formula | C13H14N2O4S |
| Molecular Weight | 294.33 g/mol |
| Exact Mass | 294.07 |
| IUPAC Name | diethyl 2-thieno[3,2-d]pyrimidin-4-ylpropanedioate |
| SMILES | CCOC(=O)C(C(=O)OCC)c1ncnc2ccsc12 |
| InChI | InChI=1S/C13H14N2O4S/c1-3-18-12(16)9(13(17)19-4-2)10-11-8(5-6-20-11)14-7-15-10/h5-7,9H,3-4H2,1-2H3 |
| InChIKey | FEVTUTZCJJCZFD-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 78.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.33 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|