C11H17F2N3 — CID 104583945
1-(2,2-difluoroethyl)-N-hex-5-en-2-ylpyrazol-3-amine (PubChem CID 104583945) has the molecular formula C11H17F2N3 and a molecular weight of 229.27 g/mol. Its IUPAC name is 1-(2,2-difluoroethyl)-N-hex-5-en-2-ylpyrazol-3-amine.
| Compound Name | 1-(2,2-difluoroethyl)-N-hex-5-en-2-ylpyrazol-3-amine |
|---|---|
| PubChem CID | 104583945 |
| Molecular Formula | C11H17F2N3 |
| Molecular Weight | 229.27 g/mol |
| Exact Mass | 229.14 |
| IUPAC Name | 1-(2,2-difluoroethyl)-N-hex-5-en-2-ylpyrazol-3-amine |
| SMILES | C=CCCC(C)Nc1ccn(CC(F)F)n1 |
| InChI | InChI=1S/C11H17F2N3/c1-3-4-5-9(2)14-11-6-7-16(15-11)8-10(12)13/h3,6-7,9-10H,1,4-5,8H2,2H3,(H,14,15) |
| InChIKey | UJIUEKPXXCEKHZ-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.27 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|