C15H24N5O12P — CID 10458529
[(2R,3S,4R,5R)-5-[4-carbamoyl-5-[[(E)-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]iminomethyl]amino]imidazol-1-yl]-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate (PubChem CID 10458529) has the molecular formula C15H24N5O12P and a molecular weight of 497.35 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-[4-carbamoyl-5-[[(E)-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]iminomethyl]amino]imidazol-1-yl]-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate.
| Compound Name | [(2R,3S,4R,5R)-5-[4-carbamoyl-5-[[(E)-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]iminomethyl]amino]imidazol-1-yl]-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 10458529 |
| Molecular Formula | C15H24N5O12P |
| Molecular Weight | 497.35 g/mol |
| Exact Mass | 497.12 |
| IUPAC Name | [(2R,3S,4R,5R)-5-[4-carbamoyl-5-[[(E)-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]iminomethyl]amino]imidazol-1-yl]-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate |
| SMILES | NC(=O)c1ncn([C@@H]2O[C@H](COP(=O)(O)O)[C@@H](O)[C@H]2O)c1N/C=N/[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C15H24N5O12P/c16-12(26)7-13(17-3-18-14-10(24)8(22)5(1-21)31-14)20(4-19-7)15-11(25)9(23)6(32-15)2-30-33(27,28)29/h3-6,8-11,14-15,21-25H,1-2H2,(H2,16,26)(H,17,18)(H2,27,28,29)/t5-,6-,8-,9-,10-,11-,14-,15-/m1/s1 |
| InChIKey | PFXLCDARODTZLP-KEOHHSTQSA-N |
| XLogP | -4.41 |
| TPSA | 271.67 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.35 |
| LogP ≤ 5 | -4.41 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|