C28H32BF4OP — CID 10458709
triphenyl-[[(1R,2S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy]phosphanium tetrafluoroborate (PubChem CID 10458709) has the molecular formula C28H32BF4OP and a molecular weight of 502.34 g/mol. Its IUPAC name is triphenyl-[[(1R,2S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy]phosphanium tetrafluoroborate.
| Compound Name | triphenyl-[[(1R,2S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy]phosphanium tetrafluoroborate |
|---|---|
| PubChem CID | 10458709 |
| Molecular Formula | C28H32BF4OP |
| Molecular Weight | 502.34 g/mol |
| Exact Mass | 502.22 |
| IUPAC Name | triphenyl-[[(1R,2S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy]phosphanium tetrafluoroborate |
| SMILES | CC1(C)[C@@H]2CC[C@@]1(C)[C@@H](O[P+](c1ccccc1)(c1ccccc1)c1ccccc1)C2.F[B-](F)(F)F |
| InChI | InChI=1S/C28H32OP.BF4/c1-27(2)22-19-20-28(27,3)26(21-22)29-30(23-13-7-4-8-14-23,24-15-9-5-10-16-24)25-17-11-6-12-18-25;2-1(3,4)5/h4-18,22,26H,19-21H2,1-3H3;/q+1;-1/t22-,26+,28+;/m1./s1 |
| InChIKey | PNAZMNWNLXZXMJ-SRYVKRMGSA-N |
| XLogP | 7.43 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.34 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|