C15H22ClNO2S2 — CID 104589822
N-[(2-chloro-6-methylsulfonylphenyl)methyl]-3-ethylsulfanylcyclopentan-1-amine (PubChem CID 104589822) has the molecular formula C15H22ClNO2S2 and a molecular weight of 347.93 g/mol. Its IUPAC name is N-[(2-chloro-6-methylsulfonylphenyl)methyl]-3-ethylsulfanylcyclopentan-1-amine.
| Compound Name | N-[(2-chloro-6-methylsulfonylphenyl)methyl]-3-ethylsulfanylcyclopentan-1-amine |
|---|---|
| PubChem CID | 104589822 |
| Molecular Formula | C15H22ClNO2S2 |
| Molecular Weight | 347.93 g/mol |
| Exact Mass | 347.08 |
| IUPAC Name | N-[(2-chloro-6-methylsulfonylphenyl)methyl]-3-ethylsulfanylcyclopentan-1-amine |
| SMILES | CCSC1CCC(NCc2c(Cl)cccc2S(C)(=O)=O)C1 |
| InChI | InChI=1S/C15H22ClNO2S2/c1-3-20-12-8-7-11(9-12)17-10-13-14(16)5-4-6-15(13)21(2,18)19/h4-6,11-12,17H,3,7-10H2,1-2H3 |
| InChIKey | SKLPQOSILCKZMW-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.93 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |