C8H13F3N2O2S — CID 104594561
1-(1-oxothian-4-yl)-3-(2,2,2-trifluoroethyl)urea (PubChem CID 104594561) has the molecular formula C8H13F3N2O2S and a molecular weight of 258.26 g/mol. Its IUPAC name is 1-(1-oxothian-4-yl)-3-(2,2,2-trifluoroethyl)urea.
| Compound Name | 1-(1-oxothian-4-yl)-3-(2,2,2-trifluoroethyl)urea |
|---|---|
| PubChem CID | 104594561 |
| Molecular Formula | C8H13F3N2O2S |
| Molecular Weight | 258.26 g/mol |
| Exact Mass | 258.06 |
| IUPAC Name | 1-(1-oxothian-4-yl)-3-(2,2,2-trifluoroethyl)urea |
| SMILES | O=C(NCC(F)(F)F)NC1CCS(=O)CC1 |
| InChI | InChI=1S/C8H13F3N2O2S/c9-8(10,11)5-12-7(14)13-6-1-3-16(15)4-2-6/h6H,1-5H2,(H2,12,13,14) |
| InChIKey | DJEJPWGADNUHOI-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.26 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |