C8H13F3N2O3S — CID 113236754
1-(1,1-dioxothian-3-yl)-3-(2,2,2-trifluoroethyl)urea (PubChem CID 113236754) has the molecular formula C8H13F3N2O3S and a molecular weight of 274.26 g/mol. Its IUPAC name is 1-(1,1-dioxothian-3-yl)-3-(2,2,2-trifluoroethyl)urea.
| Compound Name | 1-(1,1-dioxothian-3-yl)-3-(2,2,2-trifluoroethyl)urea |
|---|---|
| PubChem CID | 113236754 |
| Molecular Formula | C8H13F3N2O3S |
| Molecular Weight | 274.26 g/mol |
| Exact Mass | 274.06 |
| IUPAC Name | 1-(1,1-dioxothian-3-yl)-3-(2,2,2-trifluoroethyl)urea |
| SMILES | O=C(NCC(F)(F)F)NC1CCCS(=O)(=O)C1 |
| InChI | InChI=1S/C8H13F3N2O3S/c9-8(10,11)5-12-7(14)13-6-2-1-3-17(15,16)4-6/h6H,1-5H2,(H2,12,13,14) |
| InChIKey | IJIQTFMSNBKUAV-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.26 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |