C6H9F3N2O3S — CID 108865977
1-(1,1-dioxothiolan-3-yl)-3-(trifluoromethyl)urea (PubChem CID 108865977) has the molecular formula C6H9F3N2O3S and a molecular weight of 246.21 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-3-(trifluoromethyl)urea.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-3-(trifluoromethyl)urea |
|---|---|
| PubChem CID | 108865977 |
| Molecular Formula | C6H9F3N2O3S |
| Molecular Weight | 246.21 g/mol |
| Exact Mass | 246.03 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-3-(trifluoromethyl)urea |
| SMILES | O=C(NC1CCS(=O)(=O)C1)NC(F)(F)F |
| InChI | InChI=1S/C6H9F3N2O3S/c7-6(8,9)11-5(12)10-4-1-2-15(13,14)3-4/h4H,1-3H2,(H2,10,11,12) |
| InChIKey | PNBLPKUHWNISHG-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.21 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|