C14H25F3N2O2 — CID 104596442
N-(3-ethoxypropyl)-2-methyl-N-(2,2,2-trifluoroethyl)piperidine-2-carboxamide (PubChem CID 104596442) has the molecular formula C14H25F3N2O2 and a molecular weight of 310.36 g/mol. Its IUPAC name is N-(3-ethoxypropyl)-2-methyl-N-(2,2,2-trifluoroethyl)piperidine-2-carboxamide.
| Compound Name | N-(3-ethoxypropyl)-2-methyl-N-(2,2,2-trifluoroethyl)piperidine-2-carboxamide |
|---|---|
| PubChem CID | 104596442 |
| Molecular Formula | C14H25F3N2O2 |
| Molecular Weight | 310.36 g/mol |
| Exact Mass | 310.19 |
| IUPAC Name | N-(3-ethoxypropyl)-2-methyl-N-(2,2,2-trifluoroethyl)piperidine-2-carboxamide |
| SMILES | CCOCCCN(CC(F)(F)F)C(=O)C1(C)CCCCN1 |
| InChI | InChI=1S/C14H25F3N2O2/c1-3-21-10-6-9-19(11-14(15,16)17)12(20)13(2)7-4-5-8-18-13/h18H,3-11H2,1-2H3 |
| InChIKey | FAXURQFBWQFGSK-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.36 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|