C6H11N3OS — CID 104602128
5-(3-hydroxypropyl)-2-methyl-1H-1,2,4-triazole-3-thione (PubChem CID 104602128) has the molecular formula C6H11N3OS and a molecular weight of 173.24 g/mol. Its IUPAC name is 5-(3-hydroxypropyl)-2-methyl-1H-1,2,4-triazole-3-thione.
| Compound Name | 5-(3-hydroxypropyl)-2-methyl-1H-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 104602128 |
| Molecular Formula | C6H11N3OS |
| Molecular Weight | 173.24 g/mol |
| Exact Mass | 173.06 |
| IUPAC Name | 5-(3-hydroxypropyl)-2-methyl-1H-1,2,4-triazole-3-thione |
| SMILES | Cn1[nH]c(CCCO)nc1=S |
| InChI | InChI=1S/C6H11N3OS/c1-9-6(11)7-5(8-9)3-2-4-10/h10H,2-4H2,1H3,(H,7,8,11) |
| InChIKey | FXOXUSVMAOZDLH-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 53.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.24 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|