C16H22F13NO4P+ — CID 10460641
2-[hydroxy-[(E)-6,6,7,7,8,8,9,9,10,10,11,11,11-tridecafluoroundec-1-enoxy]phosphoryl]oxyethyl-trimethylazanium (PubChem CID 10460641) has the molecular formula C16H22F13NO4P+ and a molecular weight of 570.30 g/mol. Its IUPAC name is 2-[hydroxy-[(E)-6,6,7,7,8,8,9,9,10,10,11,11,11-tridecafluoroundec-1-enoxy]phosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[hydroxy-[(E)-6,6,7,7,8,8,9,9,10,10,11,11,11-tridecafluoroundec-1-enoxy]phosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 10460641 |
| Molecular Formula | C16H22F13NO4P+ |
| Molecular Weight | 570.30 g/mol |
| Exact Mass | 570.11 |
| IUPAC Name | 2-[hydroxy-[(E)-6,6,7,7,8,8,9,9,10,10,11,11,11-tridecafluoroundec-1-enoxy]phosphoryl]oxyethyl-trimethylazanium |
| SMILES | C[N+](C)(C)CCOP(=O)(O)O/C=C/CCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C16H21F13NO4P/c1-30(2,3)8-10-34-35(31,32)33-9-6-4-5-7-11(17,18)12(19,20)13(21,22)14(23,24)15(25,26)16(27,28)29/h6,9H,4-5,7-8,10H2,1-3H3/p+1/b9-6+ |
| InChIKey | YTMNDCFJRIYLAY-RMKNXTFCSA-O |
| XLogP | 6.25 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.30 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|