C27H43F3N2O5S — CID 10460976
2-[[3-[(5R,7E,9E,11E)-5-hydroxyicosa-7,9,11-trien-6-yl]sulfanyl-2-[(2,2,2-trifluoroacetyl)amino]propanoyl]amino]acetic acid (PubChem CID 10460976) has the molecular formula C27H43F3N2O5S and a molecular weight of 564.71 g/mol. Its IUPAC name is 2-[[3-[(5R,7E,9E,11E)-5-hydroxyicosa-7,9,11-trien-6-yl]sulfanyl-2-[(2,2,2-trifluoroacetyl)amino]propanoyl]amino]acetic acid.
| Compound Name | 2-[[3-[(5R,7E,9E,11E)-5-hydroxyicosa-7,9,11-trien-6-yl]sulfanyl-2-[(2,2,2-trifluoroacetyl)amino]propanoyl]amino]acetic acid |
|---|---|
| PubChem CID | 10460976 |
| Molecular Formula | C27H43F3N2O5S |
| Molecular Weight | 564.71 g/mol |
| Exact Mass | 564.28 |
| IUPAC Name | 2-[[3-[(5R,7E,9E,11E)-5-hydroxyicosa-7,9,11-trien-6-yl]sulfanyl-2-[(2,2,2-trifluoroacetyl)amino]propanoyl]amino]acetic acid |
| SMILES | CCCCCCCC/C=C/C=C/C=C/C(SCC(NC(=O)C(F)(F)F)C(=O)NCC(=O)O)[C@H](O)CCCC |
| InChI | InChI=1S/C27H43F3N2O5S/c1-3-5-7-8-9-10-11-12-13-14-15-16-18-23(22(33)17-6-4-2)38-20-21(25(36)31-19-24(34)35)32-26(37)27(28,29)30/h12-16,18,21-23,33H,3-11,17,19-20H2,1-2H3,(H,31,36)(H,32,37)(H,34,35)/b13-12+,15-14+,18-16+/t21?,22-,23?/m1/s1 |
| InChIKey | NHZCSLNOCMREFS-TZIAZBNNSA-N |
| XLogP | 5.31 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.71 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|