C27H43F3N2O6S — CID 54357676
2-[[3-[(5S,6R)-1,5-dihydroxyicosa-7,9,11-trien-6-yl]sulfanyl-2-[(2,2,2-trifluoroacetyl)amino]propanoyl]amino]acetic acid (PubChem CID 54357676) has the molecular formula C27H43F3N2O6S and a molecular weight of 580.71 g/mol. Its IUPAC name is 2-[[3-[(5S,6R)-1,5-dihydroxyicosa-7,9,11-trien-6-yl]sulfanyl-2-[(2,2,2-trifluoroacetyl)amino]propanoyl]amino]acetic acid.
| Compound Name | 2-[[3-[(5S,6R)-1,5-dihydroxyicosa-7,9,11-trien-6-yl]sulfanyl-2-[(2,2,2-trifluoroacetyl)amino]propanoyl]amino]acetic acid |
|---|---|
| PubChem CID | 54357676 |
| Molecular Formula | C27H43F3N2O6S |
| Molecular Weight | 580.71 g/mol |
| Exact Mass | 580.28 |
| IUPAC Name | 2-[[3-[(5S,6R)-1,5-dihydroxyicosa-7,9,11-trien-6-yl]sulfanyl-2-[(2,2,2-trifluoroacetyl)amino]propanoyl]amino]acetic acid |
| SMILES | CCCCCCCCC=CC=CC=C[C@@H](SCC(NC(=O)C(F)(F)F)C(=O)NCC(=O)O)[C@@H](O)CCCCO |
| InChI | InChI=1S/C27H43F3N2O6S/c1-2-3-4-5-6-7-8-9-10-11-12-13-17-23(22(34)16-14-15-18-33)39-20-21(25(37)31-19-24(35)36)32-26(38)27(28,29)30/h9-13,17,21-23,33-34H,2-8,14-16,18-20H2,1H3,(H,31,37)(H,32,38)(H,35,36)/t21?,22-,23+/m0/s1 |
| InChIKey | UKGLQEGMITULHD-ATTQYFOMSA-N |
| XLogP | 4.28 |
| TPSA | 135.96 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.71 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|