C27H46O — CID 10461592
(1S,2S,5R,6R,9S,10R,13S,14S)-13-(deuteriomethyl)-6,10-dimethyl-5-[(2R)-6-methylheptan-2-yl]tetracyclo[7.6.0.02,6.010,14]pentadecane-14-carbaldehyde (PubChem CID 10461592) has the molecular formula C27H46O and a molecular weight of 387.67 g/mol. Its IUPAC name is (1S,2S,5R,6R,9S,10R,13S,14S)-13-(deuteriomethyl)-6,10-dimethyl-5-[(2R)-6-methylheptan-2-yl]tetracyclo[7.6.0.02,6.010,14]pentadecane-14-carbaldehyde.
| Compound Name | (1S,2S,5R,6R,9S,10R,13S,14S)-13-(deuteriomethyl)-6,10-dimethyl-5-[(2R)-6-methylheptan-2-yl]tetracyclo[7.6.0.02,6.010,14]pentadecane-14-carbaldehyde |
|---|---|
| PubChem CID | 10461592 |
| Molecular Formula | C27H46O |
| Molecular Weight | 387.67 g/mol |
| Exact Mass | 387.36 |
| IUPAC Name | (1S,2S,5R,6R,9S,10R,13S,14S)-13-(deuteriomethyl)-6,10-dimethyl-5-[(2R)-6-methylheptan-2-yl]tetracyclo[7.6.0.02,6.010,14]pentadecane-14-carbaldehyde |
| SMILES | [2H]C[C@H]1CC[C@]2(C)[C@H]3CC[C@]4(C)[C@@H]([C@H](C)CCCC(C)C)CC[C@H]4[C@@H]3C[C@]12C=O |
| InChI | InChI=1S/C27H46O/c1-18(2)8-7-9-19(3)22-10-11-23-21-16-27(17-28)20(4)12-15-26(27,6)24(21)13-14-25(22,23)5/h17-24H,7-16H2,1-6H3/t19-,20+,21+,22-,23+,24+,25-,26-,27+/m1/s1/i4D |
| InChIKey | PDEVVQYNRCJMLN-GTWYYSCQSA-N |
| XLogP | 7.53 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.67 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|