C29H46O — CID 10740340
(1S,2R,5R,7R,8S,10S,11S,14R,15R)-7-ethynyl-2,15-dimethyl-14-[(2R)-6-methylheptan-2-yl]pentacyclo[8.7.0.02,8.05,8.011,15]heptadecan-7-ol (PubChem CID 10740340) has the molecular formula C29H46O and a molecular weight of 410.69 g/mol. Its IUPAC name is (1S,2R,5R,7R,8S,10S,11S,14R,15R)-7-ethynyl-2,15-dimethyl-14-[(2R)-6-methylheptan-2-yl]pentacyclo[8.7.0.02,8.05,8.011,15]heptadecan-7-ol.
| Compound Name | (1S,2R,5R,7R,8S,10S,11S,14R,15R)-7-ethynyl-2,15-dimethyl-14-[(2R)-6-methylheptan-2-yl]pentacyclo[8.7.0.02,8.05,8.011,15]heptadecan-7-ol |
|---|---|
| PubChem CID | 10740340 |
| Molecular Formula | C29H46O |
| Molecular Weight | 410.69 g/mol |
| Exact Mass | 410.35 |
| IUPAC Name | (1S,2R,5R,7R,8S,10S,11S,14R,15R)-7-ethynyl-2,15-dimethyl-14-[(2R)-6-methylheptan-2-yl]pentacyclo[8.7.0.02,8.05,8.011,15]heptadecan-7-ol |
| SMILES | C#C[C@]1(O)C[C@H]2CC[C@]3(C)[C@H]4CC[C@]5(C)[C@@H]([C@H](C)CCCC(C)C)CC[C@H]5[C@@H]4C[C@@]213 |
| InChI | InChI=1S/C29H46O/c1-7-28(30)17-21-13-16-27(6)25-14-15-26(5)23(20(4)10-8-9-19(2)3)11-12-24(26)22(25)18-29(21,27)28/h1,19-25,30H,8-18H2,2-6H3/t20-,21-,22+,23-,24+,25+,26-,27-,28+,29+/m1/s1 |
| InChIKey | XRXKIDDJSKQPGJ-IYXZENIWSA-N |
| XLogP | 7.08 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.69 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|