C9H15N3O2S — CID 104633479
2-amino-2-[5-(thian-2-yl)-1,2,4-oxadiazol-3-yl]ethanol (PubChem CID 104633479) has the molecular formula C9H15N3O2S and a molecular weight of 229.30 g/mol. Its IUPAC name is 2-amino-2-[5-(thian-2-yl)-1,2,4-oxadiazol-3-yl]ethanol.
| Compound Name | 2-amino-2-[5-(thian-2-yl)-1,2,4-oxadiazol-3-yl]ethanol |
|---|---|
| PubChem CID | 104633479 |
| Molecular Formula | C9H15N3O2S |
| Molecular Weight | 229.30 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | 2-amino-2-[5-(thian-2-yl)-1,2,4-oxadiazol-3-yl]ethanol |
| SMILES | NC(CO)c1noc(C2CCCCS2)n1 |
| InChI | InChI=1S/C9H15N3O2S/c10-6(5-13)8-11-9(14-12-8)7-3-1-2-4-15-7/h6-7,13H,1-5,10H2 |
| InChIKey | VJKNZQLLAUCDJX-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 85.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.30 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |