C13H21N5O2S — CID 104637010
1-propoxy-2-[5-(4-propylthiadiazol-5-yl)-1,2,4-oxadiazol-3-yl]propan-2-amine (PubChem CID 104637010) has the molecular formula C13H21N5O2S and a molecular weight of 311.41 g/mol. Its IUPAC name is 1-propoxy-2-[5-(4-propylthiadiazol-5-yl)-1,2,4-oxadiazol-3-yl]propan-2-amine.
| Compound Name | 1-propoxy-2-[5-(4-propylthiadiazol-5-yl)-1,2,4-oxadiazol-3-yl]propan-2-amine |
|---|---|
| PubChem CID | 104637010 |
| Molecular Formula | C13H21N5O2S |
| Molecular Weight | 311.41 g/mol |
| Exact Mass | 311.14 |
| IUPAC Name | 1-propoxy-2-[5-(4-propylthiadiazol-5-yl)-1,2,4-oxadiazol-3-yl]propan-2-amine |
| SMILES | CCCOCC(C)(N)c1noc(-c2snnc2CCC)n1 |
| InChI | InChI=1S/C13H21N5O2S/c1-4-6-9-10(21-18-16-9)11-15-12(17-20-11)13(3,14)8-19-7-5-2/h4-8,14H2,1-3H3 |
| InChIKey | SRUUWKBFNTUOKJ-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 99.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.41 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|