C14H12N4OS — CID 104639786
N-(1,3-benzothiazol-2-yl)-5-(methylamino)pyridine-2-carboxamide (PubChem CID 104639786) has the molecular formula C14H12N4OS and a molecular weight of 284.34 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-yl)-5-(methylamino)pyridine-2-carboxamide.
| Compound Name | N-(1,3-benzothiazol-2-yl)-5-(methylamino)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 104639786 |
| Molecular Formula | C14H12N4OS |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.07 |
| IUPAC Name | N-(1,3-benzothiazol-2-yl)-5-(methylamino)pyridine-2-carboxamide |
| SMILES | CNc1ccc(C(=O)Nc2nc3ccccc3s2)nc1 |
| InChI | InChI=1S/C14H12N4OS/c1-15-9-6-7-11(16-8-9)13(19)18-14-17-10-4-2-3-5-12(10)20-14/h2-8,15H,1H3,(H,17,18,19) |
| InChIKey | XVSHOOVPPZGVDO-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |