C12H12ClN3S — CID 10468071
2-benzyl-6-chloro-6,7-dihydro-5H-[1,2,4]triazolo[5,1-b][1,3]thiazine (PubChem CID 10468071) has the molecular formula C12H12ClN3S and a molecular weight of 265.77 g/mol. Its IUPAC name is 2-benzyl-6-chloro-6,7-dihydro-5H-[1,2,4]triazolo[5,1-b][1,3]thiazine.
| Compound Name | 2-benzyl-6-chloro-6,7-dihydro-5H-[1,2,4]triazolo[5,1-b][1,3]thiazine |
|---|---|
| PubChem CID | 10468071 |
| Molecular Formula | C12H12ClN3S |
| Molecular Weight | 265.77 g/mol |
| Exact Mass | 265.04 |
| IUPAC Name | 2-benzyl-6-chloro-6,7-dihydro-5H-[1,2,4]triazolo[5,1-b][1,3]thiazine |
| SMILES | ClC1CSc2nc(Cc3ccccc3)nn2C1 |
| InChI | InChI=1S/C12H12ClN3S/c13-10-7-16-12(17-8-10)14-11(15-16)6-9-4-2-1-3-5-9/h1-5,10H,6-8H2 |
| InChIKey | YCNKLKLGBKYRKL-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.77 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|