C15H20N4S — CID 16751720
2-benzyl-6-butyl-5,7-dihydro-[1,2,4]triazolo[5,1-b][1,3,5]thiadiazine (PubChem CID 16751720) has the molecular formula C15H20N4S and a molecular weight of 288.42 g/mol. Its IUPAC name is 2-benzyl-6-butyl-5,7-dihydro-[1,2,4]triazolo[5,1-b][1,3,5]thiadiazine.
| Compound Name | 2-benzyl-6-butyl-5,7-dihydro-[1,2,4]triazolo[5,1-b][1,3,5]thiadiazine |
|---|---|
| PubChem CID | 16751720 |
| Molecular Formula | C15H20N4S |
| Molecular Weight | 288.42 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | 2-benzyl-6-butyl-5,7-dihydro-[1,2,4]triazolo[5,1-b][1,3,5]thiadiazine |
| SMILES | CCCCN1CSc2nc(Cc3ccccc3)nn2C1 |
| InChI | InChI=1S/C15H20N4S/c1-2-3-9-18-11-19-15(20-12-18)16-14(17-19)10-13-7-5-4-6-8-13/h4-8H,2-3,9-12H2,1H3 |
| InChIKey | CCWPRFWXFDOKDL-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.42 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |